C13H11F5N2OS — CID 135989651
2-[(1S)-1-(2,6-difluorophenyl)ethyl]imino-5-methyl-5-(trifluoromethyl)-1,3-thiazolidin-4-one (PubChem CID 135989651) has the molecular formula C13H11F5N2OS and a molecular weight of 338.30 g/mol. Its IUPAC name is 2-[(1S)-1-(2,6-difluorophenyl)ethyl]imino-5-methyl-5-(trifluoromethyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-[(1S)-1-(2,6-difluorophenyl)ethyl]imino-5-methyl-5-(trifluoromethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135989651 |
| Molecular Formula | C13H11F5N2OS |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 2-[(1S)-1-(2,6-difluorophenyl)ethyl]imino-5-methyl-5-(trifluoromethyl)-1,3-thiazolidin-4-one |
| SMILES | C[C@H](/N=C1\NC(=O)C(C)(C(F)(F)F)S1)c1c(F)cccc1F |
| InChI | InChI=1S/C13H11F5N2OS/c1-6(9-7(14)4-3-5-8(9)15)19-11-20-10(21)12(2,22-11)13(16,17)18/h3-6H,1-2H3,(H,19,20,21)/t6-,12?/m0/s1 |
| InChIKey | DJUULUGDNVNXDN-RLWMBFFFSA-N |
| XLogP | 3.57 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|