C13H13F3N2O2S — CID 136595581
(5R)-2-[(2-methoxyphenyl)methylimino]-5-methyl-5-(trifluoromethyl)-1,3-thiazolidin-4-one (PubChem CID 136595581) has the molecular formula C13H13F3N2O2S and a molecular weight of 318.32 g/mol. Its IUPAC name is (5R)-2-[(2-methoxyphenyl)methylimino]-5-methyl-5-(trifluoromethyl)-1,3-thiazolidin-4-one.
| Compound Name | (5R)-2-[(2-methoxyphenyl)methylimino]-5-methyl-5-(trifluoromethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136595581 |
| Molecular Formula | C13H13F3N2O2S |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | (5R)-2-[(2-methoxyphenyl)methylimino]-5-methyl-5-(trifluoromethyl)-1,3-thiazolidin-4-one |
| SMILES | COc1ccccc1C/N=C1\NC(=O)[C@](C)(C(F)(F)F)S1 |
| InChI | InChI=1S/C13H13F3N2O2S/c1-12(13(14,15)16)10(19)18-11(21-12)17-7-8-5-3-4-6-9(8)20-2/h3-6H,7H2,1-2H3,(H,17,18,19)/t12-/m1/s1 |
| InChIKey | ZRTJITOGLUEPER-GFCCVEGCSA-N |
| XLogP | 2.74 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|