C11H14F3NO3S — CID 143860168
2,2,2-trifluoro-N-[2-(2-methoxyphenyl)ethyl]ethanesulfonamide (PubChem CID 143860168) has the molecular formula C11H14F3NO3S and a molecular weight of 297.30 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-(2-methoxyphenyl)ethyl]ethanesulfonamide.
| Compound Name | 2,2,2-trifluoro-N-[2-(2-methoxyphenyl)ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 143860168 |
| Molecular Formula | C11H14F3NO3S |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-(2-methoxyphenyl)ethyl]ethanesulfonamide |
| SMILES | COc1ccccc1CCNS(=O)(=O)CC(F)(F)F |
| InChI | InChI=1S/C11H14F3NO3S/c1-18-10-5-3-2-4-9(10)6-7-15-19(16,17)8-11(12,13)14/h2-5,15H,6-8H2,1H3 |
| InChIKey | DXXBLRFOXWCMTF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |