C18H18FN3O3S2 — CID 135989728
4-[2-[(1S)-1-(2-fluorophenyl)ethyl]imino-5-methyl-4-oxo-1,3-thiazolidin-5-yl]benzenesulfonamide (PubChem CID 135989728) has the molecular formula C18H18FN3O3S2 and a molecular weight of 407.49 g/mol. Its IUPAC name is 4-[2-[(1S)-1-(2-fluorophenyl)ethyl]imino-5-methyl-4-oxo-1,3-thiazolidin-5-yl]benzenesulfonamide.
| Compound Name | 4-[2-[(1S)-1-(2-fluorophenyl)ethyl]imino-5-methyl-4-oxo-1,3-thiazolidin-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 135989728 |
| Molecular Formula | C18H18FN3O3S2 |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 4-[2-[(1S)-1-(2-fluorophenyl)ethyl]imino-5-methyl-4-oxo-1,3-thiazolidin-5-yl]benzenesulfonamide |
| SMILES | C[C@H](/N=C1\NC(=O)C(C)(c2ccc(S(N)(=O)=O)cc2)S1)c1ccccc1F |
| InChI | InChI=1S/C18H18FN3O3S2/c1-11(14-5-3-4-6-15(14)19)21-17-22-16(23)18(2,26-17)12-7-9-13(10-8-12)27(20,24)25/h3-11H,1-2H3,(H2,20,24,25)(H,21,22,23)/t11-,18?/m0/s1 |
| InChIKey | IKIMPWQADAHRHO-FAQQKDIKSA-N |
| XLogP | 2.67 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|