C17H20FN3O2S — CID 135989240
2-[(1S)-1-(2-fluorophenyl)ethyl]imino-5-methyl-5-(2-oxopiperidin-4-yl)-1,3-thiazolidin-4-one (PubChem CID 135989240) has the molecular formula C17H20FN3O2S and a molecular weight of 349.43 g/mol. Its IUPAC name is 2-[(1S)-1-(2-fluorophenyl)ethyl]imino-5-methyl-5-(2-oxopiperidin-4-yl)-1,3-thiazolidin-4-one.
| Compound Name | 2-[(1S)-1-(2-fluorophenyl)ethyl]imino-5-methyl-5-(2-oxopiperidin-4-yl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135989240 |
| Molecular Formula | C17H20FN3O2S |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 2-[(1S)-1-(2-fluorophenyl)ethyl]imino-5-methyl-5-(2-oxopiperidin-4-yl)-1,3-thiazolidin-4-one |
| SMILES | C[C@H](/N=C1/NC(=O)C(C)(C2CCNC(=O)C2)S1)c1ccccc1F |
| InChI | InChI=1S/C17H20FN3O2S/c1-10(12-5-3-4-6-13(12)18)20-16-21-15(23)17(2,24-16)11-7-8-19-14(22)9-11/h3-6,10-11H,7-9H2,1-2H3,(H,19,22)(H,20,21,23)/t10-,11?,17?/m0/s1 |
| InChIKey | XUXJXFDGANSIHD-KCCQOBMMSA-N |
| XLogP | 2.39 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|