C17H16FN3OS — CID 135989261
(5S)-2-[(1S)-1-(4-fluorophenyl)ethyl]imino-5-methyl-5-pyridin-2-yl-1,3-thiazolidin-4-one (PubChem CID 135989261) has the molecular formula C17H16FN3OS and a molecular weight of 329.40 g/mol. Its IUPAC name is (5S)-2-[(1S)-1-(4-fluorophenyl)ethyl]imino-5-methyl-5-pyridin-2-yl-1,3-thiazolidin-4-one.
| Compound Name | (5S)-2-[(1S)-1-(4-fluorophenyl)ethyl]imino-5-methyl-5-pyridin-2-yl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135989261 |
| Molecular Formula | C17H16FN3OS |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | (5S)-2-[(1S)-1-(4-fluorophenyl)ethyl]imino-5-methyl-5-pyridin-2-yl-1,3-thiazolidin-4-one |
| SMILES | C[C@H](/N=C1\NC(=O)[C@](C)(c2ccccn2)S1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H16FN3OS/c1-11(12-6-8-13(18)9-7-12)20-16-21-15(22)17(2,23-16)14-5-3-4-10-19-14/h3-11H,1-2H3,(H,20,21,22)/t11-,17-/m0/s1 |
| InChIKey | DZKGGDSNEGWXCO-GTNSWQLSSA-N |
| XLogP | 3.42 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|