C19H22FN3O2S — CID 135611046
5-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-2-[(1S)-1-(4-fluorophenyl)ethyl]imino-5-methyl-1,3-thiazolidin-4-one (PubChem CID 135611046) has the molecular formula C19H22FN3O2S and a molecular weight of 375.47 g/mol. Its IUPAC name is 5-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-2-[(1S)-1-(4-fluorophenyl)ethyl]imino-5-methyl-1,3-thiazolidin-4-one.
| Compound Name | 5-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-2-[(1S)-1-(4-fluorophenyl)ethyl]imino-5-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135611046 |
| Molecular Formula | C19H22FN3O2S |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 5-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-2-[(1S)-1-(4-fluorophenyl)ethyl]imino-5-methyl-1,3-thiazolidin-4-one |
| SMILES | CC(=O)N1CC=C(C2(C)S/C(=N\[C@@H](C)c3ccc(F)cc3)NC2=O)CC1 |
| InChI | InChI=1S/C19H22FN3O2S/c1-12(14-4-6-16(20)7-5-14)21-18-22-17(25)19(3,26-18)15-8-10-23(11-9-15)13(2)24/h4-8,12H,9-11H2,1-3H3,(H,21,22,25)/t12-,19?/m0/s1 |
| InChIKey | ANKGVKWPKNDNPA-HSLMYDHPSA-N |
| XLogP | 3.04 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|