C22H23FN2O2S — CID 143468430
2-[(1S)-1-(4-fluorophenyl)ethyl]imino-5-[[4-(1-methoxyethenyl)phenyl]methyl]-5-methyl-1,3-thiazolidin-4-one (PubChem CID 143468430) has the molecular formula C22H23FN2O2S and a molecular weight of 398.50 g/mol. Its IUPAC name is 2-[(1S)-1-(4-fluorophenyl)ethyl]imino-5-[[4-(1-methoxyethenyl)phenyl]methyl]-5-methyl-1,3-thiazolidin-4-one.
| Compound Name | 2-[(1S)-1-(4-fluorophenyl)ethyl]imino-5-[[4-(1-methoxyethenyl)phenyl]methyl]-5-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 143468430 |
| Molecular Formula | C22H23FN2O2S |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 2-[(1S)-1-(4-fluorophenyl)ethyl]imino-5-[[4-(1-methoxyethenyl)phenyl]methyl]-5-methyl-1,3-thiazolidin-4-one |
| SMILES | C=C(OC)c1ccc(CC2(C)S/C(=N\[C@@H](C)c3ccc(F)cc3)NC2=O)cc1 |
| InChI | InChI=1S/C22H23FN2O2S/c1-14(17-9-11-19(23)12-10-17)24-21-25-20(26)22(3,28-21)13-16-5-7-18(8-6-16)15(2)27-4/h5-12,14H,2,13H2,1,3-4H3,(H,24,25,26)/t14-,22?/m0/s1 |
| InChIKey | FBFRQLYGCBGVAE-XLEXHMCLSA-N |
| XLogP | 4.72 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|