C20H25FN2O3S — CID 135611108
5-(1,4-dioxaspiro[4.5]decan-8-yl)-2-[(1S)-1-(4-fluorophenyl)ethyl]imino-5-methyl-1,3-thiazolidin-4-one (PubChem CID 135611108) has the molecular formula C20H25FN2O3S and a molecular weight of 392.50 g/mol. Its IUPAC name is 5-(1,4-dioxaspiro[4.5]decan-8-yl)-2-[(1S)-1-(4-fluorophenyl)ethyl]imino-5-methyl-1,3-thiazolidin-4-one.
| Compound Name | 5-(1,4-dioxaspiro[4.5]decan-8-yl)-2-[(1S)-1-(4-fluorophenyl)ethyl]imino-5-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135611108 |
| Molecular Formula | C20H25FN2O3S |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 5-(1,4-dioxaspiro[4.5]decan-8-yl)-2-[(1S)-1-(4-fluorophenyl)ethyl]imino-5-methyl-1,3-thiazolidin-4-one |
| SMILES | C[C@H](/N=C1/NC(=O)C(C)(C2CCC3(CC2)OCCO3)S1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H25FN2O3S/c1-13(14-3-5-16(21)6-4-14)22-18-23-17(24)19(2,27-18)15-7-9-20(10-8-15)25-11-12-26-20/h3-6,13,15H,7-12H2,1-2H3,(H,22,23,24)/t13-,19?/m0/s1 |
| InChIKey | NDYOZOHBOXNKJB-YTJLLHSVSA-N |
| XLogP | 3.80 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|