C14H17FN2O2S — CID 143147233
(5S)-2-[(1S)-1-(4-fluorophenyl)ethyl]imino-5-(1-hydroxyethyl)-5-methyl-1,3-thiazolidin-4-one (PubChem CID 143147233) has the molecular formula C14H17FN2O2S and a molecular weight of 296.37 g/mol. Its IUPAC name is (5S)-2-[(1S)-1-(4-fluorophenyl)ethyl]imino-5-(1-hydroxyethyl)-5-methyl-1,3-thiazolidin-4-one.
| Compound Name | (5S)-2-[(1S)-1-(4-fluorophenyl)ethyl]imino-5-(1-hydroxyethyl)-5-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 143147233 |
| Molecular Formula | C14H17FN2O2S |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | (5S)-2-[(1S)-1-(4-fluorophenyl)ethyl]imino-5-(1-hydroxyethyl)-5-methyl-1,3-thiazolidin-4-one |
| SMILES | CC(O)[C@]1(C)S/C(=N/[C@@H](C)c2ccc(F)cc2)NC1=O |
| InChI | InChI=1S/C14H17FN2O2S/c1-8(10-4-6-11(15)7-5-10)16-13-17-12(19)14(3,20-13)9(2)18/h4-9,18H,1-3H3,(H,16,17,19)/t8-,9?,14-/m0/s1 |
| InChIKey | GBDDHLWLIICOOZ-JBLYATSQSA-N |
| XLogP | 2.25 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|