C14H19N3OS — CID 135989340
(5R)-5-methyl-5-propan-2-yl-2-[(1R)-1-pyridin-4-ylethyl]imino-1,3-thiazolidin-4-one (PubChem CID 135989340) has the molecular formula C14H19N3OS and a molecular weight of 277.39 g/mol. Its IUPAC name is (5R)-5-methyl-5-propan-2-yl-2-[(1R)-1-pyridin-4-ylethyl]imino-1,3-thiazolidin-4-one.
| Compound Name | (5R)-5-methyl-5-propan-2-yl-2-[(1R)-1-pyridin-4-ylethyl]imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135989340 |
| Molecular Formula | C14H19N3OS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | (5R)-5-methyl-5-propan-2-yl-2-[(1R)-1-pyridin-4-ylethyl]imino-1,3-thiazolidin-4-one |
| SMILES | CC(C)[C@@]1(C)S/C(=N/[C@H](C)c2ccncc2)NC1=O |
| InChI | InChI=1S/C14H19N3OS/c1-9(2)14(4)12(18)17-13(19-14)16-10(3)11-5-7-15-8-6-11/h5-10H,1-4H3,(H,16,17,18)/t10-,14-/m1/s1 |
| InChIKey | YUHCLYSPSFWULF-QMTHXVAHSA-N |
| XLogP | 2.78 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|