C21H22N2O3S — CID 143467947
methyl 4-[5-methyl-2-[(1S)-1-(4-methylphenyl)ethyl]imino-4-oxo-1,3-thiazolidin-5-yl]benzoate (PubChem CID 143467947) has the molecular formula C21H22N2O3S and a molecular weight of 382.49 g/mol. Its IUPAC name is methyl 4-[5-methyl-2-[(1S)-1-(4-methylphenyl)ethyl]imino-4-oxo-1,3-thiazolidin-5-yl]benzoate.
| Compound Name | methyl 4-[5-methyl-2-[(1S)-1-(4-methylphenyl)ethyl]imino-4-oxo-1,3-thiazolidin-5-yl]benzoate |
|---|---|
| PubChem CID | 143467947 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | methyl 4-[5-methyl-2-[(1S)-1-(4-methylphenyl)ethyl]imino-4-oxo-1,3-thiazolidin-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2(C)S/C(=N\[C@@H](C)c3ccc(C)cc3)NC2=O)cc1 |
| InChI | InChI=1S/C21H22N2O3S/c1-13-5-7-15(8-6-13)14(2)22-20-23-19(25)21(3,27-20)17-11-9-16(10-12-17)18(24)26-4/h5-12,14H,1-4H3,(H,22,23,25)/t14-,21?/m0/s1 |
| InChIKey | RKQXIVAEOJOPPE-YXWRBFHGSA-N |
| XLogP | 3.98 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|