C21H19F3N2O3S — CID 135989744
methyl 4-[5-methyl-4-oxo-2-[(1S)-1-[2-(trifluoromethyl)phenyl]ethyl]imino-1,3-thiazolidin-5-yl]benzoate (PubChem CID 135989744) has the molecular formula C21H19F3N2O3S and a molecular weight of 436.46 g/mol. Its IUPAC name is methyl 4-[5-methyl-4-oxo-2-[(1S)-1-[2-(trifluoromethyl)phenyl]ethyl]imino-1,3-thiazolidin-5-yl]benzoate.
| Compound Name | methyl 4-[5-methyl-4-oxo-2-[(1S)-1-[2-(trifluoromethyl)phenyl]ethyl]imino-1,3-thiazolidin-5-yl]benzoate |
|---|---|
| PubChem CID | 135989744 |
| Molecular Formula | C21H19F3N2O3S |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | methyl 4-[5-methyl-4-oxo-2-[(1S)-1-[2-(trifluoromethyl)phenyl]ethyl]imino-1,3-thiazolidin-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2(C)S/C(=N\[C@@H](C)c3ccccc3C(F)(F)F)NC2=O)cc1 |
| InChI | InChI=1S/C21H19F3N2O3S/c1-12(15-6-4-5-7-16(15)21(22,23)24)25-19-26-18(28)20(2,30-19)14-10-8-13(9-11-14)17(27)29-3/h4-12H,1-3H3,(H,25,26,28)/t12-,20?/m0/s1 |
| InChIKey | WDOUVKZPQMBYKC-SVZXGPMESA-N |
| XLogP | 4.69 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|