C21H26ClN3OS — CID 143467950
5-[4-(aminomethyl)phenyl]-2-[(1S)-1-(2-chlorophenyl)ethyl]imino-5-methyl-1,3-thiazolidin-4-one;ethane (PubChem CID 143467950) has the molecular formula C21H26ClN3OS and a molecular weight of 403.98 g/mol. Its IUPAC name is 5-[4-(aminomethyl)phenyl]-2-[(1S)-1-(2-chlorophenyl)ethyl]imino-5-methyl-1,3-thiazolidin-4-one;ethane.
| Compound Name | 5-[4-(aminomethyl)phenyl]-2-[(1S)-1-(2-chlorophenyl)ethyl]imino-5-methyl-1,3-thiazolidin-4-one;ethane |
|---|---|
| PubChem CID | 143467950 |
| Molecular Formula | C21H26ClN3OS |
| Molecular Weight | 403.98 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 5-[4-(aminomethyl)phenyl]-2-[(1S)-1-(2-chlorophenyl)ethyl]imino-5-methyl-1,3-thiazolidin-4-one;ethane |
| SMILES | CC.C[C@H](/N=C1/NC(=O)C(C)(c2ccc(CN)cc2)S1)c1ccccc1Cl |
| InChI | InChI=1S/C19H20ClN3OS.C2H6/c1-12(15-5-3-4-6-16(15)20)22-18-23-17(24)19(2,25-18)14-9-7-13(11-21)8-10-14;1-2/h3-10,12H,11,21H2,1-2H3,(H,22,23,24);1-2H3/t12-,19?;/m0./s1 |
| InChIKey | WPBKVDWDGHTKMQ-NXOPJEDISA-N |
| XLogP | 5.02 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.98 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|