C15H19ClN2O2S — CID 143468539
2-[(1S)-1-(2-chlorophenyl)ethyl]imino-5-(2-hydroxypropan-2-yl)-1,3-thiazinan-4-one (PubChem CID 143468539) has the molecular formula C15H19ClN2O2S and a molecular weight of 326.85 g/mol. Its IUPAC name is 2-[(1S)-1-(2-chlorophenyl)ethyl]imino-5-(2-hydroxypropan-2-yl)-1,3-thiazinan-4-one.
| Compound Name | 2-[(1S)-1-(2-chlorophenyl)ethyl]imino-5-(2-hydroxypropan-2-yl)-1,3-thiazinan-4-one |
|---|---|
| PubChem CID | 143468539 |
| Molecular Formula | C15H19ClN2O2S |
| Molecular Weight | 326.85 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-[(1S)-1-(2-chlorophenyl)ethyl]imino-5-(2-hydroxypropan-2-yl)-1,3-thiazinan-4-one |
| SMILES | C[C@H](/N=C1/NC(=O)C(C(C)(C)O)CS1)c1ccccc1Cl |
| InChI | InChI=1S/C15H19ClN2O2S/c1-9(10-6-4-5-7-12(10)16)17-14-18-13(19)11(8-21-14)15(2,3)20/h4-7,9,11,20H,8H2,1-3H3,(H,17,18,19)/t9-,11?/m0/s1 |
| InChIKey | LAGNBUPZLZFYLY-FTNKSUMCSA-N |
| XLogP | 3.01 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.85 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|