C21H18F3N3O5 — CID 95788343
[(2S)-1-oxo-1-[2-(trifluoromethyl)anilino]propan-2-yl] 4-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzoate (PubChem CID 95788343) has the molecular formula C21H18F3N3O5 and a molecular weight of 449.39 g/mol. Its IUPAC name is [(2S)-1-oxo-1-[2-(trifluoromethyl)anilino]propan-2-yl] 4-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzoate.
| Compound Name | [(2S)-1-oxo-1-[2-(trifluoromethyl)anilino]propan-2-yl] 4-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzoate |
|---|---|
| PubChem CID | 95788343 |
| Molecular Formula | C21H18F3N3O5 |
| Molecular Weight | 449.39 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | [(2S)-1-oxo-1-[2-(trifluoromethyl)anilino]propan-2-yl] 4-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzoate |
| SMILES | C[C@H](OC(=O)c1ccc([C@@]2(C)NC(=O)NC2=O)cc1)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H18F3N3O5/c1-11(16(28)25-15-6-4-3-5-14(15)21(22,23)24)32-17(29)12-7-9-13(10-8-12)20(2)18(30)26-19(31)27-20/h3-11H,1-2H3,(H,25,28)(H2,26,27,30,31)/t11-,20+/m0/s1 |
| InChIKey | NLMAQRYIRQMXGR-PRWKNARSSA-N |
| XLogP | 2.94 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|