C18H15F4NO4 — CID 8975917
[(2S)-1-oxo-1-[2-(trifluoromethyl)anilino]propan-2-yl] 2-fluoro-4-methoxybenzoate (PubChem CID 8975917) has the molecular formula C18H15F4NO4 and a molecular weight of 385.31 g/mol. Its IUPAC name is [(2S)-1-oxo-1-[2-(trifluoromethyl)anilino]propan-2-yl] 2-fluoro-4-methoxybenzoate.
| Compound Name | [(2S)-1-oxo-1-[2-(trifluoromethyl)anilino]propan-2-yl] 2-fluoro-4-methoxybenzoate |
|---|---|
| PubChem CID | 8975917 |
| Molecular Formula | C18H15F4NO4 |
| Molecular Weight | 385.31 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | [(2S)-1-oxo-1-[2-(trifluoromethyl)anilino]propan-2-yl] 2-fluoro-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)O[C@@H](C)C(=O)Nc2ccccc2C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C18H15F4NO4/c1-10(27-17(25)12-8-7-11(26-2)9-14(12)19)16(24)23-15-6-4-3-5-13(15)18(20,21)22/h3-10H,1-2H3,(H,23,24)/t10-/m0/s1 |
| InChIKey | OHLOSDPVAIYPOT-JTQLQIEISA-N |
| XLogP | 4.04 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.31 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |