C14H18FNO5 — CID 8975813
[(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 2-fluoro-4-methoxybenzoate (PubChem CID 8975813) has the molecular formula C14H18FNO5 and a molecular weight of 299.30 g/mol. Its IUPAC name is [(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 2-fluoro-4-methoxybenzoate.
| Compound Name | [(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 2-fluoro-4-methoxybenzoate |
|---|---|
| PubChem CID | 8975813 |
| Molecular Formula | C14H18FNO5 |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | [(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 2-fluoro-4-methoxybenzoate |
| SMILES | COCCNC(=O)[C@@H](C)OC(=O)c1ccc(OC)cc1F |
| InChI | InChI=1S/C14H18FNO5/c1-9(13(17)16-6-7-19-2)21-14(18)11-5-4-10(20-3)8-12(11)15/h4-5,8-9H,6-7H2,1-3H3,(H,16,17)/t9-/m1/s1 |
| InChIKey | QEHMVVQENLGILQ-SECBINFHSA-N |
| XLogP | 1.14 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|