C19H16FNO4S — CID 158311508
5-[[4-[2-(4-fluorophenyl)-2-oxoethoxy]phenyl]methyl]-5-methyl-1,3-thiazolidine-2,4-dione (PubChem CID 158311508) has the molecular formula C19H16FNO4S and a molecular weight of 373.41 g/mol. Its IUPAC name is 5-[[4-[2-(4-fluorophenyl)-2-oxoethoxy]phenyl]methyl]-5-methyl-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-(4-fluorophenyl)-2-oxoethoxy]phenyl]methyl]-5-methyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 158311508 |
| Molecular Formula | C19H16FNO4S |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 5-[[4-[2-(4-fluorophenyl)-2-oxoethoxy]phenyl]methyl]-5-methyl-1,3-thiazolidine-2,4-dione |
| SMILES | CC1(Cc2ccc(OCC(=O)c3ccc(F)cc3)cc2)SC(=O)NC1=O |
| InChI | InChI=1S/C19H16FNO4S/c1-19(17(23)21-18(24)26-19)10-12-2-8-15(9-3-12)25-11-16(22)13-4-6-14(20)7-5-13/h2-9H,10-11H2,1H3,(H,21,23,24) |
| InChIKey | XREJOKSRHRAVTD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|