C20H18FN3O3S — CID 46175712
5-[[4-[2-(5-fluoroindazol-2-yl)ethoxy]phenyl]methyl]-5-methyl-1,3-thiazolidine-2,4-dione (PubChem CID 46175712) has the molecular formula C20H18FN3O3S and a molecular weight of 399.45 g/mol. Its IUPAC name is 5-[[4-[2-(5-fluoroindazol-2-yl)ethoxy]phenyl]methyl]-5-methyl-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-(5-fluoroindazol-2-yl)ethoxy]phenyl]methyl]-5-methyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 46175712 |
| Molecular Formula | C20H18FN3O3S |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 5-[[4-[2-(5-fluoroindazol-2-yl)ethoxy]phenyl]methyl]-5-methyl-1,3-thiazolidine-2,4-dione |
| SMILES | CC1(Cc2ccc(OCCn3cc4cc(F)ccc4n3)cc2)SC(=O)NC1=O |
| InChI | InChI=1S/C20H18FN3O3S/c1-20(18(25)22-19(26)28-20)11-13-2-5-16(6-3-13)27-9-8-24-12-14-10-15(21)4-7-17(14)23-24/h2-7,10,12H,8-9,11H2,1H3,(H,22,25,26) |
| InChIKey | MDLFJGLXLNMZDD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|