C28H28N4O4S — CID 158315106
5-[[4-[[6-(4-amino-3,5-dimethylphenoxy)-1-methylbenzimidazol-2-yl]methoxy]phenyl]methyl]-5-methyl-1,3-thiazolidine-2,4-dione (PubChem CID 158315106) has the molecular formula C28H28N4O4S and a molecular weight of 516.62 g/mol. Its IUPAC name is 5-[[4-[[6-(4-amino-3,5-dimethylphenoxy)-1-methylbenzimidazol-2-yl]methoxy]phenyl]methyl]-5-methyl-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[[6-(4-amino-3,5-dimethylphenoxy)-1-methylbenzimidazol-2-yl]methoxy]phenyl]methyl]-5-methyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 158315106 |
| Molecular Formula | C28H28N4O4S |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | 5-[[4-[[6-(4-amino-3,5-dimethylphenoxy)-1-methylbenzimidazol-2-yl]methoxy]phenyl]methyl]-5-methyl-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cc(Oc2ccc3nc(COc4ccc(CC5(C)SC(=O)NC5=O)cc4)n(C)c3c2)cc(C)c1N |
| InChI | InChI=1S/C28H28N4O4S/c1-16-11-21(12-17(2)25(16)29)36-20-9-10-22-23(13-20)32(4)24(30-22)15-35-19-7-5-18(6-8-19)14-28(3)26(33)31-27(34)37-28/h5-13H,14-15,29H2,1-4H3,(H,31,33,34) |
| InChIKey | RMIFRUSJGUIUJA-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|