C39H36N4O5 — CID 21137739
3-[4-[[6-(4-amino-3,5-dimethylphenoxy)-1-methylbenzimidazol-2-yl]methoxy]phenyl]-2-(2-benzoylanilino)propanoic acid (PubChem CID 21137739) has the molecular formula C39H36N4O5 and a molecular weight of 640.74 g/mol. Its IUPAC name is 3-[4-[[6-(4-amino-3,5-dimethylphenoxy)-1-methylbenzimidazol-2-yl]methoxy]phenyl]-2-(2-benzoylanilino)propanoic acid.
| Compound Name | 3-[4-[[6-(4-amino-3,5-dimethylphenoxy)-1-methylbenzimidazol-2-yl]methoxy]phenyl]-2-(2-benzoylanilino)propanoic acid |
|---|---|
| PubChem CID | 21137739 |
| Molecular Formula | C39H36N4O5 |
| Molecular Weight | 640.74 g/mol |
| Exact Mass | 640.27 |
| IUPAC Name | 3-[4-[[6-(4-amino-3,5-dimethylphenoxy)-1-methylbenzimidazol-2-yl]methoxy]phenyl]-2-(2-benzoylanilino)propanoic acid |
| SMILES | Cc1cc(Oc2ccc3nc(COc4ccc(CC(Nc5ccccc5C(=O)c5ccccc5)C(=O)O)cc4)n(C)c3c2)cc(C)c1N |
| InChI | InChI=1S/C39H36N4O5/c1-24-19-30(20-25(2)37(24)40)48-29-17-18-33-35(22-29)43(3)36(42-33)23-47-28-15-13-26(14-16-28)21-34(39(45)46)41-32-12-8-7-11-31(32)38(44)27-9-5-4-6-10-27/h4-20,22,34,41H,21,23,40H2,1-3H3,(H,45,46) |
| InChIKey | QRNICDMCXPTRDG-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.74 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|