C26H22N4O6 — CID 46176151
5-benzyl-5-[[4-[2-(5-nitroindazol-2-yl)ethoxy]phenyl]methyl]-1,3-oxazolidine-2,4-dione (PubChem CID 46176151) has the molecular formula C26H22N4O6 and a molecular weight of 486.48 g/mol. Its IUPAC name is 5-benzyl-5-[[4-[2-(5-nitroindazol-2-yl)ethoxy]phenyl]methyl]-1,3-oxazolidine-2,4-dione.
| Compound Name | 5-benzyl-5-[[4-[2-(5-nitroindazol-2-yl)ethoxy]phenyl]methyl]-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 46176151 |
| Molecular Formula | C26H22N4O6 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 5-benzyl-5-[[4-[2-(5-nitroindazol-2-yl)ethoxy]phenyl]methyl]-1,3-oxazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cc2ccccc2)(Cc2ccc(OCCn3cc4cc([N+](=O)[O-])ccc4n3)cc2)O1 |
| InChI | InChI=1S/C26H22N4O6/c31-24-26(36-25(32)27-24,15-18-4-2-1-3-5-18)16-19-6-9-22(10-7-19)35-13-12-29-17-20-14-21(30(33)34)8-11-23(20)28-29/h1-11,14,17H,12-13,15-16H2,(H,27,31,32) |
| InChIKey | AYTCBHGFUWAXLK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|