C25H27NO — CID 21474132
1-[4-(2-prop-2-enyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone (PubChem CID 21474132) has the molecular formula C25H27NO and a molecular weight of 357.50 g/mol. Its IUPAC name is 1-[4-(2-prop-2-enyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone.
| Compound Name | 1-[4-(2-prop-2-enyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 21474132 |
| Molecular Formula | C25H27NO |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 1-[4-(2-prop-2-enyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone |
| SMILES | C=CCC1(C2=CCN(C(C)=O)CC2)c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C25H27NO/c1-3-16-25(22-14-17-26(18-15-22)19(2)27)23-10-6-4-8-20(23)12-13-21-9-5-7-11-24(21)25/h3-11,14H,1,12-13,15-18H2,2H3 |
| InChIKey | IMXRLHRXGRYDRG-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|