C9H12O — CID 102097578
4,5-dimethylspiro[2.4]hept-5-en-7-one (PubChem CID 102097578) has the molecular formula C9H12O and a molecular weight of 136.19 g/mol. Its IUPAC name is 4,5-dimethylspiro[2.4]hept-5-en-7-one.
| Compound Name | 4,5-dimethylspiro[2.4]hept-5-en-7-one |
|---|---|
| PubChem CID | 102097578 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | 4,5-dimethylspiro[2.4]hept-5-en-7-one |
| SMILES | CC1=CC(=O)C2(CC2)C1C |
| InChI | InChI=1S/C9H12O/c1-6-5-8(10)9(3-4-9)7(6)2/h5,7H,3-4H2,1-2H3 |
| InChIKey | XGGBIMHDAYWNHN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |