C15H17NO2 — CID 118439880
(5S)-1-(hydroxyiminomethyl)-2,5,7-trimethylspiro[5H-indene-6,1'-cyclopropane]-4-one (PubChem CID 118439880) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is (5S)-1-(hydroxyiminomethyl)-2,5,7-trimethylspiro[5H-indene-6,1'-cyclopropane]-4-one.
| Compound Name | (5S)-1-(hydroxyiminomethyl)-2,5,7-trimethylspiro[5H-indene-6,1'-cyclopropane]-4-one |
|---|---|
| PubChem CID | 118439880 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | (5S)-1-(hydroxyiminomethyl)-2,5,7-trimethylspiro[5H-indene-6,1'-cyclopropane]-4-one |
| SMILES | CC1=C(C=NO)C2=C(C)C3(CC3)[C@H](C)C(=O)C2=C1 |
| InChI | InChI=1S/C15H17NO2/c1-8-6-11-13(12(8)7-16-18)9(2)15(4-5-15)10(3)14(11)17/h6-7,10,18H,4-5H2,1-3H3/t10-/m1/s1 |
| InChIKey | XIFTUWHXKFVFLP-SNVBAGLBSA-N |
| XLogP | 3.02 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|