C19H24O3 — CID 121458934
3-[(5S)-2,5,7-trimethyl-4-oxospiro[5H-indene-6,1'-cyclopropane]-1-yl]propyl acetate (PubChem CID 121458934) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is 3-[(5S)-2,5,7-trimethyl-4-oxospiro[5H-indene-6,1'-cyclopropane]-1-yl]propyl acetate.
| Compound Name | 3-[(5S)-2,5,7-trimethyl-4-oxospiro[5H-indene-6,1'-cyclopropane]-1-yl]propyl acetate |
|---|---|
| PubChem CID | 121458934 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 3-[(5S)-2,5,7-trimethyl-4-oxospiro[5H-indene-6,1'-cyclopropane]-1-yl]propyl acetate |
| SMILES | CC(=O)OCCCC1=C(C)C=C2C(=O)[C@@H](C)C3(CC3)C(C)=C21 |
| InChI | InChI=1S/C19H24O3/c1-11-10-16-17(15(11)6-5-9-22-14(4)20)12(2)19(7-8-19)13(3)18(16)21/h10,13H,5-9H2,1-4H3/t13-/m1/s1 |
| InChIKey | RDZLFQUHMPJUEU-CYBMUJFWSA-N |
| XLogP | 3.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|