C22H28O6 — CID 163041870
3-[(4bS,8aR,9R)-1,9-dihydroxy-4b,7,8-trimethyl-3,4-dioxo-6,8a,9,10-tetrahydro-5H-phenanthren-2-yl]propyl acetate (PubChem CID 163041870) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is 3-[(4bS,8aR,9R)-1,9-dihydroxy-4b,7,8-trimethyl-3,4-dioxo-6,8a,9,10-tetrahydro-5H-phenanthren-2-yl]propyl acetate.
| Compound Name | 3-[(4bS,8aR,9R)-1,9-dihydroxy-4b,7,8-trimethyl-3,4-dioxo-6,8a,9,10-tetrahydro-5H-phenanthren-2-yl]propyl acetate |
|---|---|
| PubChem CID | 163041870 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 3-[(4bS,8aR,9R)-1,9-dihydroxy-4b,7,8-trimethyl-3,4-dioxo-6,8a,9,10-tetrahydro-5H-phenanthren-2-yl]propyl acetate |
| SMILES | CC(=O)OCCCC1=C(O)C2=C(C(=O)C1=O)[C@@]1(C)CCC(C)=C(C)[C@H]1[C@H](O)C2 |
| InChI | InChI=1S/C22H28O6/c1-11-7-8-22(4)17(12(11)2)16(24)10-15-18(22)21(27)20(26)14(19(15)25)6-5-9-28-13(3)23/h16-17,24-25H,5-10H2,1-4H3/t16-,17+,22+/m1/s1 |
| InChIKey | DAEYXNWXSOTJGH-JLHGSKIFSA-N |
| XLogP | 3.11 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|