C22H28O7 — CID 162919403
(4aR,5S,6S,9R,10R,12bS)-5,9-dihydroxy-6,10-dimethoxy-3,4,12b-trimethyl-1,2,4a,5,6,8,9,10-octahydronaphtho[2,1-g]chromene-7,12-dione (PubChem CID 162919403) has the molecular formula C22H28O7 and a molecular weight of 404.46 g/mol. Its IUPAC name is (4aR,5S,6S,9R,10R,12bS)-5,9-dihydroxy-6,10-dimethoxy-3,4,12b-trimethyl-1,2,4a,5,6,8,9,10-octahydronaphtho[2,1-g]chromene-7,12-dione.
| Compound Name | (4aR,5S,6S,9R,10R,12bS)-5,9-dihydroxy-6,10-dimethoxy-3,4,12b-trimethyl-1,2,4a,5,6,8,9,10-octahydronaphtho[2,1-g]chromene-7,12-dione |
|---|---|
| PubChem CID | 162919403 |
| Molecular Formula | C22H28O7 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | (4aR,5S,6S,9R,10R,12bS)-5,9-dihydroxy-6,10-dimethoxy-3,4,12b-trimethyl-1,2,4a,5,6,8,9,10-octahydronaphtho[2,1-g]chromene-7,12-dione |
| SMILES | CO[C@@H]1OC2=C(C[C@H]1O)C(=O)C1=C(C2=O)[C@@]2(C)CCC(C)=C(C)[C@H]2[C@H](O)[C@H]1OC |
| InChI | InChI=1S/C22H28O7/c1-9-6-7-22(3)14(10(9)2)17(25)20(27-4)13-15(22)18(26)19-11(16(13)24)8-12(23)21(28-5)29-19/h12,14,17,20-21,23,25H,6-8H2,1-5H3/t12-,14+,17+,20+,21-,22+/m1/s1 |
| InChIKey | IEFIUHLKOQZIJM-HHEJQNEJSA-N |
| XLogP | 1.58 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|