C19H26O2 — CID 15463283
(6R,8S,9S,10R,14S)-6-hydroxy-10,17-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 15463283) has the molecular formula C19H26O2 and a molecular weight of 286.41 g/mol. Its IUPAC name is (6R,8S,9S,10R,14S)-6-hydroxy-10,17-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (6R,8S,9S,10R,14S)-6-hydroxy-10,17-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 15463283 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (6R,8S,9S,10R,14S)-6-hydroxy-10,17-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC1=C2CC[C@H]3[C@@H](C[C@@H](O)C4=CC(=O)CC[C@@]43C)[C@@H]2CC1 |
| InChI | InChI=1S/C19H26O2/c1-11-3-4-14-13(11)5-6-16-15(14)10-18(21)17-9-12(20)7-8-19(16,17)2/h9,14-16,18,21H,3-8,10H2,1-2H3/t14-,15+,16+,18-,19-/m1/s1 |
| InChIKey | ANCJITLNISKHLX-WHEVEAIOSA-N |
| XLogP | 3.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|