C21H28O6 — CID 163058084
1,9-dihydroxy-2-(2-hydroxypropyl)-10-methoxy-4b,7-dimethyl-8-methylidene-5,6,7,8a,9,10-hexahydrophenanthrene-3,4-dione (PubChem CID 163058084) has the molecular formula C21H28O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is 1,9-dihydroxy-2-(2-hydroxypropyl)-10-methoxy-4b,7-dimethyl-8-methylidene-5,6,7,8a,9,10-hexahydrophenanthrene-3,4-dione.
| Compound Name | 1,9-dihydroxy-2-(2-hydroxypropyl)-10-methoxy-4b,7-dimethyl-8-methylidene-5,6,7,8a,9,10-hexahydrophenanthrene-3,4-dione |
|---|---|
| PubChem CID | 163058084 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 1,9-dihydroxy-2-(2-hydroxypropyl)-10-methoxy-4b,7-dimethyl-8-methylidene-5,6,7,8a,9,10-hexahydrophenanthrene-3,4-dione |
| SMILES | C=C1C(C)CCC2(C)C3=C(C(O)=C(CC(C)O)C(=O)C3=O)C(OC)C(O)C12 |
| InChI | InChI=1S/C21H28O6/c1-9-6-7-21(4)14(11(9)3)19(26)20(27-5)13-15(21)18(25)17(24)12(16(13)23)8-10(2)22/h9-10,14,19-20,22-23,26H,3,6-8H2,1-2,4-5H3 |
| InChIKey | YOPMLBWMDPUGDC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|