C21H26O7 — CID 162895502
[(1S,4aS,10aR)-5,8-dihydroxy-7-[(2S)-2-hydroxypropyl]-1,4a-dimethyl-6,10-dioxo-2,3,4,10a-tetrahydrophenanthren-1-yl]methyl formate (PubChem CID 162895502) has the molecular formula C21H26O7 and a molecular weight of 390.43 g/mol. Its IUPAC name is [(1S,4aS,10aR)-5,8-dihydroxy-7-[(2S)-2-hydroxypropyl]-1,4a-dimethyl-6,10-dioxo-2,3,4,10a-tetrahydrophenanthren-1-yl]methyl formate.
| Compound Name | [(1S,4aS,10aR)-5,8-dihydroxy-7-[(2S)-2-hydroxypropyl]-1,4a-dimethyl-6,10-dioxo-2,3,4,10a-tetrahydrophenanthren-1-yl]methyl formate |
|---|---|
| PubChem CID | 162895502 |
| Molecular Formula | C21H26O7 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | [(1S,4aS,10aR)-5,8-dihydroxy-7-[(2S)-2-hydroxypropyl]-1,4a-dimethyl-6,10-dioxo-2,3,4,10a-tetrahydrophenanthren-1-yl]methyl formate |
| SMILES | C[C@H](O)CC1=C(O)C2=CC(=O)[C@H]3[C@@](C)(COC=O)CCC[C@]3(C)C2=C(O)C1=O |
| InChI | InChI=1S/C21H26O7/c1-11(23)7-13-16(25)12-8-14(24)19-20(2,9-28-10-22)5-4-6-21(19,3)15(12)18(27)17(13)26/h8,10-11,19,23,25,27H,4-7,9H2,1-3H3/t11-,19-,20+,21+/m0/s1 |
| InChIKey | OYRCBHVWIXQNCI-GWXWPONQSA-N |
| XLogP | 2.46 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|