C21H30O4 — CID 162992044
4,9-dihydroxy-1-methoxy-4b,8,8-trimethyl-2-propan-2-yl-6,7,8a,9-tetrahydro-5H-phenanthren-3-one (PubChem CID 162992044) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is 4,9-dihydroxy-1-methoxy-4b,8,8-trimethyl-2-propan-2-yl-6,7,8a,9-tetrahydro-5H-phenanthren-3-one.
| Compound Name | 4,9-dihydroxy-1-methoxy-4b,8,8-trimethyl-2-propan-2-yl-6,7,8a,9-tetrahydro-5H-phenanthren-3-one |
|---|---|
| PubChem CID | 162992044 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 4,9-dihydroxy-1-methoxy-4b,8,8-trimethyl-2-propan-2-yl-6,7,8a,9-tetrahydro-5H-phenanthren-3-one |
| SMILES | COC1=C(C(C)C)C(=O)C(O)=C2C1=CC(O)C1C(C)(C)CCCC21C |
| InChI | InChI=1S/C21H30O4/c1-11(2)14-16(23)17(24)15-12(18(14)25-6)10-13(22)19-20(3,4)8-7-9-21(15,19)5/h10-11,13,19,22,24H,7-9H2,1-6H3 |
| InChIKey | QXZHEHCNJCJSDX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |