C21H26O7 — CID 162990586
methyl (1S,4aS,10aS)-5,8-dihydroxy-7-[(2S)-2-hydroxypropyl]-1,4a-dimethyl-6,10-dioxo-2,3,4,10a-tetrahydrophenanthrene-1-carboxylate (PubChem CID 162990586) has the molecular formula C21H26O7 and a molecular weight of 390.43 g/mol. Its IUPAC name is methyl (1S,4aS,10aS)-5,8-dihydroxy-7-[(2S)-2-hydroxypropyl]-1,4a-dimethyl-6,10-dioxo-2,3,4,10a-tetrahydrophenanthrene-1-carboxylate.
| Compound Name | methyl (1S,4aS,10aS)-5,8-dihydroxy-7-[(2S)-2-hydroxypropyl]-1,4a-dimethyl-6,10-dioxo-2,3,4,10a-tetrahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 162990586 |
| Molecular Formula | C21H26O7 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | methyl (1S,4aS,10aS)-5,8-dihydroxy-7-[(2S)-2-hydroxypropyl]-1,4a-dimethyl-6,10-dioxo-2,3,4,10a-tetrahydrophenanthrene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CCC[C@]2(C)C3=C(O)C(=O)C(C[C@H](C)O)=C(O)C3=CC(=O)[C@H]12 |
| InChI | InChI=1S/C21H26O7/c1-10(22)8-12-15(24)11-9-13(23)18-20(2,14(11)17(26)16(12)25)6-5-7-21(18,3)19(27)28-4/h9-10,18,22,24,26H,5-8H2,1-4H3/t10-,18-,20+,21-/m0/s1 |
| InChIKey | WQGFBHNHPUKLDM-CNQBRWFOSA-N |
| XLogP | 2.46 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |