C15H24OSi2 — CID 85424284
7,9-bis(trimethylsilyl)tetracyclo[4.3.0.02,9.05,7]non-3-en-8-one (PubChem CID 85424284) has the molecular formula C15H24OSi2 and a molecular weight of 276.53 g/mol. Its IUPAC name is 7,9-bis(trimethylsilyl)tetracyclo[4.3.0.02,9.05,7]non-3-en-8-one.
| Compound Name | 7,9-bis(trimethylsilyl)tetracyclo[4.3.0.02,9.05,7]non-3-en-8-one |
|---|---|
| PubChem CID | 85424284 |
| Molecular Formula | C15H24OSi2 |
| Molecular Weight | 276.53 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 7,9-bis(trimethylsilyl)tetracyclo[4.3.0.02,9.05,7]non-3-en-8-one |
| SMILES | C[Si](C)(C)C12C(=O)C3([Si](C)(C)C)C4C=CC1C2C43 |
| InChI | InChI=1S/C15H24OSi2/c1-17(2,3)14-9-7-8-10-12(11(9)14)15(10,13(14)16)18(4,5)6/h7-12H,1-6H3 |
| InChIKey | FIZQZDULLBAPHI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|