C14H18O2 — CID 570790
10-butyl-10-hydroxytricyclo[4.2.1.12,5]deca-3,7-dien-9-one (PubChem CID 570790) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 10-butyl-10-hydroxytricyclo[4.2.1.12,5]deca-3,7-dien-9-one.
| Compound Name | 10-butyl-10-hydroxytricyclo[4.2.1.12,5]deca-3,7-dien-9-one |
|---|---|
| PubChem CID | 570790 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 10-butyl-10-hydroxytricyclo[4.2.1.12,5]deca-3,7-dien-9-one |
| SMILES | CCCCC1(O)C2C=CC1C1C=CC2C1=O |
| InChI | InChI=1S/C14H18O2/c1-2-3-8-14(16)11-6-7-12(14)10-5-4-9(11)13(10)15/h4-7,9-12,16H,2-3,8H2,1H3 |
| InChIKey | RZZGLZLZWPZOAV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|