C16H20O2 — CID 172773786
9-butyltetracyclo[6.2.1.13,6.02,7]dodec-4-ene-11,12-dione (PubChem CID 172773786) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is 9-butyltetracyclo[6.2.1.13,6.02,7]dodec-4-ene-11,12-dione.
| Compound Name | 9-butyltetracyclo[6.2.1.13,6.02,7]dodec-4-ene-11,12-dione |
|---|---|
| PubChem CID | 172773786 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 9-butyltetracyclo[6.2.1.13,6.02,7]dodec-4-ene-11,12-dione |
| SMILES | CCCCC1CC2C(=O)C1C1C3C=CC(C3=O)C21 |
| InChI | InChI=1S/C16H20O2/c1-2-3-4-8-7-11-13-9-5-6-10(15(9)17)14(13)12(8)16(11)18/h5-6,8-14H,2-4,7H2,1H3 |
| InChIKey | NHSZJKXQBRBOKQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|