C19H34O3 — CID 11544105
(2S,3R,3aS,4R,6S,6aS)-3-butyl-4,6-bis(hydroxymethyl)-2-pentyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-one (PubChem CID 11544105) has the molecular formula C19H34O3 and a molecular weight of 310.48 g/mol. Its IUPAC name is (2S,3R,3aS,4R,6S,6aS)-3-butyl-4,6-bis(hydroxymethyl)-2-pentyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-one.
| Compound Name | (2S,3R,3aS,4R,6S,6aS)-3-butyl-4,6-bis(hydroxymethyl)-2-pentyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-one |
|---|---|
| PubChem CID | 11544105 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | (2S,3R,3aS,4R,6S,6aS)-3-butyl-4,6-bis(hydroxymethyl)-2-pentyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-one |
| SMILES | CCCCC[C@@H]1C(=O)[C@@H]2[C@@H](CO)C[C@@H](CO)[C@@H]2[C@H]1CCCC |
| InChI | InChI=1S/C19H34O3/c1-3-5-7-9-16-15(8-6-4-2)17-13(11-20)10-14(12-21)18(17)19(16)22/h13-18,20-21H,3-12H2,1-2H3/t13-,14+,15-,16-,17+,18+/m0/s1 |
| InChIKey | KHIGUBIFQVUKNS-YPLQCARHSA-N |
| XLogP | 3.43 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|