C22H28O4 — CID 172694859
cyclooctyl 2-(11,12-dioxo-4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)acetate (PubChem CID 172694859) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is cyclooctyl 2-(11,12-dioxo-4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)acetate.
| Compound Name | cyclooctyl 2-(11,12-dioxo-4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)acetate |
|---|---|
| PubChem CID | 172694859 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | cyclooctyl 2-(11,12-dioxo-4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)acetate |
| SMILES | O=C(CC1CC2C(=O)C1C1C3C=CC(C3=O)C21)OC1CCCCCCC1 |
| InChI | InChI=1S/C22H28O4/c23-17(26-13-6-4-2-1-3-5-7-13)11-12-10-16-19-14-8-9-15(21(14)24)20(19)18(12)22(16)25/h8-9,12-16,18-20H,1-7,10-11H2 |
| InChIKey | CEKOONOLARZLEA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|