C19H14O5 — CID 15921750
15-oxaoctacyclo[10.5.2.12,8.02,11.03,7.04,11.05,9.013,17]icos-18-ene-10,14,16,20-tetrone (PubChem CID 15921750) has the molecular formula C19H14O5 and a molecular weight of 322.32 g/mol. Its IUPAC name is 15-oxaoctacyclo[10.5.2.12,8.02,11.03,7.04,11.05,9.013,17]icos-18-ene-10,14,16,20-tetrone.
| Compound Name | 15-oxaoctacyclo[10.5.2.12,8.02,11.03,7.04,11.05,9.013,17]icos-18-ene-10,14,16,20-tetrone |
|---|---|
| PubChem CID | 15921750 |
| Molecular Formula | C19H14O5 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 15-oxaoctacyclo[10.5.2.12,8.02,11.03,7.04,11.05,9.013,17]icos-18-ene-10,14,16,20-tetrone |
| SMILES | O=C1OC(=O)C2C1C1C=CC2C23C(=O)C4C5CC6C4C(=O)C12C6C53 |
| InChI | InChI=1S/C19H14O5/c20-14-8-4-3-5-9(8)15(21)19-7-2-1-6(18(14,19)12(4)13(5)19)10-11(7)17(23)24-16(10)22/h1-2,4-13H,3H2 |
| InChIKey | GDXYBKDRPNLDSM-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|