C16H14O3 — CID 124923402
(1R,2R,7R,8R,9S,13S)-11-oxapentacyclo[6.5.2.22,7.02,7.09,13]heptadeca-4,14,16-triene-10,12-dione (PubChem CID 124923402) has the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. Its IUPAC name is (1R,2R,7R,8R,9S,13S)-11-oxapentacyclo[6.5.2.22,7.02,7.09,13]heptadeca-4,14,16-triene-10,12-dione.
| Compound Name | (1R,2R,7R,8R,9S,13S)-11-oxapentacyclo[6.5.2.22,7.02,7.09,13]heptadeca-4,14,16-triene-10,12-dione |
|---|---|
| PubChem CID | 124923402 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | (1R,2R,7R,8R,9S,13S)-11-oxapentacyclo[6.5.2.22,7.02,7.09,13]heptadeca-4,14,16-triene-10,12-dione |
| SMILES | O=C1OC(=O)[C@@H]2[C@@H]1[C@H]1C=C[C@H]2[C@@]23C=C[C@]12CC=CC3 |
| InChI | InChI=1S/C16H14O3/c17-13-11-9-3-4-10(12(11)14(18)19-13)16-6-2-1-5-15(9,16)7-8-16/h1-4,7-12H,5-6H2/t9-,10-,11+,12+,15-,16-/m1/s1 |
| InChIKey | MBOCWUFISKKKSD-ZNNLQBODSA-N |
| XLogP | 2.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|