C16H16N2O2 — CID 94035015
(1S,2R,7S,8R)-11-methyl-9,13-diazapentacyclo[6.5.2.22,7.02,7.09,13]heptadeca-4,14,16-triene-10,12-dione (PubChem CID 94035015) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is (1S,2R,7S,8R)-11-methyl-9,13-diazapentacyclo[6.5.2.22,7.02,7.09,13]heptadeca-4,14,16-triene-10,12-dione.
| Compound Name | (1S,2R,7S,8R)-11-methyl-9,13-diazapentacyclo[6.5.2.22,7.02,7.09,13]heptadeca-4,14,16-triene-10,12-dione |
|---|---|
| PubChem CID | 94035015 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | (1S,2R,7S,8R)-11-methyl-9,13-diazapentacyclo[6.5.2.22,7.02,7.09,13]heptadeca-4,14,16-triene-10,12-dione |
| SMILES | CC1C(=O)N2[C@H]3C=C[C@@H](N2C1=O)[C@@]12C=C[C@@]31CC=CC2 |
| InChI | InChI=1S/C16H16N2O2/c1-10-13(19)17-11-4-5-12(18(17)14(10)20)16-7-3-2-6-15(11,16)8-9-16/h2-5,8-12H,6-7H2,1H3/t10?,11-,12+,15-,16+ |
| InChIKey | ZUQFEDJMKOQRPE-UGTXJPTRSA-N |
| XLogP | 1.42 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|