C10H13NO — CID 122205838
(3S,9aR)-3-methyl-3,6,9,9a-tetrahydroquinolizin-4-one (PubChem CID 122205838) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is (3S,9aR)-3-methyl-3,6,9,9a-tetrahydroquinolizin-4-one.
| Compound Name | (3S,9aR)-3-methyl-3,6,9,9a-tetrahydroquinolizin-4-one |
|---|---|
| PubChem CID | 122205838 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (3S,9aR)-3-methyl-3,6,9,9a-tetrahydroquinolizin-4-one |
| SMILES | C[C@H]1C=C[C@H]2CC=CCN2C1=O |
| InChI | InChI=1S/C10H13NO/c1-8-5-6-9-4-2-3-7-11(9)10(8)12/h2-3,5-6,8-9H,4,7H2,1H3/t8-,9+/m0/s1 |
| InChIKey | JRDYKYMCZWOWGI-DTWKUNHWSA-N |
| XLogP | 1.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|