C10H13NO2 — CID 101200406
(4S,9aS)-4,6,9,9a-tetrahydro-3H-quinolizine-4-carboxylic acid (PubChem CID 101200406) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is (4S,9aS)-4,6,9,9a-tetrahydro-3H-quinolizine-4-carboxylic acid.
| Compound Name | (4S,9aS)-4,6,9,9a-tetrahydro-3H-quinolizine-4-carboxylic acid |
|---|---|
| PubChem CID | 101200406 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (4S,9aS)-4,6,9,9a-tetrahydro-3H-quinolizine-4-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC=C[C@@H]2CC=CCN21 |
| InChI | InChI=1S/C10H13NO2/c12-10(13)9-6-3-5-8-4-1-2-7-11(8)9/h1-3,5,8-9H,4,6-7H2,(H,12,13)/t8-,9-/m0/s1 |
| InChIKey | AHMNTXSSKNWIPY-IUCAKERBSA-N |
| XLogP | 1.03 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|