C12H11ClFNO4S — CID 166293375
1-(3-chloro-5-fluorophenyl)sulfonyl-3,6-dihydro-2H-pyridine-2-carboxylic acid (PubChem CID 166293375) has the molecular formula C12H11ClFNO4S and a molecular weight of 319.74 g/mol. Its IUPAC name is 1-(3-chloro-5-fluorophenyl)sulfonyl-3,6-dihydro-2H-pyridine-2-carboxylic acid.
| Compound Name | 1-(3-chloro-5-fluorophenyl)sulfonyl-3,6-dihydro-2H-pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 166293375 |
| Molecular Formula | C12H11ClFNO4S |
| Molecular Weight | 319.74 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | 1-(3-chloro-5-fluorophenyl)sulfonyl-3,6-dihydro-2H-pyridine-2-carboxylic acid |
| SMILES | O=C(O)C1CC=CCN1S(=O)(=O)c1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C12H11ClFNO4S/c13-8-5-9(14)7-10(6-8)20(18,19)15-4-2-1-3-11(15)12(16)17/h1-2,5-7,11H,3-4H2,(H,16,17) |
| InChIKey | OUWRRRFQDBSJJR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.74 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|