C17H15Cl2NO4S — CID 20828609
(4R)-1-(3,5-dichlorophenyl)sulfonyl-4-phenylpyrrolidine-2-carboxylic acid (PubChem CID 20828609) has the molecular formula C17H15Cl2NO4S and a molecular weight of 400.28 g/mol. Its IUPAC name is (4R)-1-(3,5-dichlorophenyl)sulfonyl-4-phenylpyrrolidine-2-carboxylic acid.
| Compound Name | (4R)-1-(3,5-dichlorophenyl)sulfonyl-4-phenylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 20828609 |
| Molecular Formula | C17H15Cl2NO4S |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | (4R)-1-(3,5-dichlorophenyl)sulfonyl-4-phenylpyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1C[C@H](c2ccccc2)CN1S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C17H15Cl2NO4S/c18-13-7-14(19)9-15(8-13)25(23,24)20-10-12(6-16(20)17(21)22)11-4-2-1-3-5-11/h1-5,7-9,12,16H,6,10H2,(H,21,22)/t12-,16?/m0/s1 |
| InChIKey | KYGNVLPSVVYUDB-HKALDPMFSA-N |
| XLogP | 3.62 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |