About (4R)-1-(3,5-dichlorophenyl)sulfonyl-4-phenylpyrrolidine-2-carboxylic acid
(4R)-1-(3,5-dichlorophenyl)sulfonyl-4-phenylpyrrolidine-2-carboxylic acid (PubChem CID 20828609) has the molecular formula C17H15Cl2NO4S
and a molecular weight of 400.28 g/mol. Its IUPAC name is (4R)-1-(3,5-dichlorophenyl)sulfonyl-4-phenylpyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | (4R)-1-(3,5-dichlorophenyl)sulfonyl-4-phenylpyrrolidine-2-carboxylic acid |
| PubChem CID | 20828609 |
| Molecular Formula | C17H15Cl2NO4S |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | (4R)-1-(3,5-dichlorophenyl)sulfonyl-4-phenylpyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1C[C@H](c2ccccc2)CN1S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C17H15Cl2NO4S/c18-13-7-14(19)9-15(8-13)25(23,24)20-10-12(6-16(20)17(21)22)11-4-2-1-3-5-11/h1-5,7-9,12,16H,6,10H2,(H,21,22)/t12-,16?/m0/s1 |
| InChIKey | KYGNVLPSVVYUDB-HKALDPMFSA-N |
| XLogP | 3.62 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-1-(3,5-dichlorophenyl)sulfonyl-4-phenylpyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-1-(3,5-dichlorophenyl)sulfonyl-4-phenylpyrrolidine-2-carboxylic acid?
The IUPAC name of (4R)-1-(3,5-dichlorophenyl)sulfonyl-4-phenylpyrrolidine-2-carboxylic acid (CID 20828609) is (4R)-1-(3,5-dichlorophenyl)sulfonyl-4-phenylpyrrolidine-2-carboxylic acid.
What is the SMILES notation for (4R)-1-(3,5-dichlorophenyl)sulfonyl-4-phenylpyrrolidine-2-carboxylic acid?
The canonical SMILES for (4R)-1-(3,5-dichlorophenyl)sulfonyl-4-phenylpyrrolidine-2-carboxylic acid is O=C(O)C1C[C@H](c2ccccc2)CN1S(=O)(=O)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of (4R)-1-(3,5-dichlorophenyl)sulfonyl-4-phenylpyrrolidine-2-carboxylic acid?
The InChIKey is KYGNVLPSVVYUDB-HKALDPMFSA-N. The full InChI is InChI=1S/C17H15Cl2NO4S/c18-13-7-14(19)9-15(8-13)25(23,24)20-10-12(6-16(20)17(21)22)11-4-2-1-3-5-11/h1-5,7-9,12,16H,6,10H2,(H,21,22)/t12-,16?/m0/s1.
What are the key properties of (4R)-1-(3,5-dichlorophenyl)sulfonyl-4-phenylpyrrolidine-2-carboxylic acid?
(4R)-1-(3,5-dichlorophenyl)sulfonyl-4-phenylpyrrolidine-2-carboxylic acid has a molecular weight of 400.28 g/mol, XLogP of 3.62, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-1-(3,5-dichlorophenyl)sulfonyl-4-phenylpyrrolidine-2-carboxylic acid is sourced from PubChem (CID 20828609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).