C17H14Cl2INO4S — CID 69351376
(2S,3R)-1-(3,5-dichlorophenyl)sulfonyl-3-(4-iodophenyl)pyrrolidine-2-carboxylic acid (PubChem CID 69351376) has the molecular formula C17H14Cl2INO4S and a molecular weight of 526.18 g/mol. Its IUPAC name is (2S,3R)-1-(3,5-dichlorophenyl)sulfonyl-3-(4-iodophenyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3R)-1-(3,5-dichlorophenyl)sulfonyl-3-(4-iodophenyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 69351376 |
| Molecular Formula | C17H14Cl2INO4S |
| Molecular Weight | 526.18 g/mol |
| Exact Mass | 524.91 |
| IUPAC Name | (2S,3R)-1-(3,5-dichlorophenyl)sulfonyl-3-(4-iodophenyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@@H](c2ccc(I)cc2)CCN1S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C17H14Cl2INO4S/c18-11-7-12(19)9-14(8-11)26(24,25)21-6-5-15(16(21)17(22)23)10-1-3-13(20)4-2-10/h1-4,7-9,15-16H,5-6H2,(H,22,23)/t15-,16+/m1/s1 |
| InChIKey | XASXOMAUIVYQSF-CVEARBPZSA-N |
| XLogP | 4.23 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.18 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|