C13H13Cl2NO6S — CID 22324512
1-(3,5-dichlorophenyl)sulfonyl-2-methylpyrrolidine-2,3-dicarboxylic acid (PubChem CID 22324512) has the molecular formula C13H13Cl2NO6S and a molecular weight of 382.22 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)sulfonyl-2-methylpyrrolidine-2,3-dicarboxylic acid.
| Compound Name | 1-(3,5-dichlorophenyl)sulfonyl-2-methylpyrrolidine-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 22324512 |
| Molecular Formula | C13H13Cl2NO6S |
| Molecular Weight | 382.22 g/mol |
| Exact Mass | 380.98 |
| IUPAC Name | 1-(3,5-dichlorophenyl)sulfonyl-2-methylpyrrolidine-2,3-dicarboxylic acid |
| SMILES | CC1(C(=O)O)C(C(=O)O)CCN1S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H13Cl2NO6S/c1-13(12(19)20)10(11(17)18)2-3-16(13)23(21,22)9-5-7(14)4-8(15)6-9/h4-6,10H,2-3H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | BKPTZPQUOJGKSV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.22 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |