C16H21ClN2O4S — CID 22324526
1-(3-chlorophenyl)sulfonyl-2-methyl-3-pyrrolidin-1-ylpyrrolidine-2-carboxylic acid (PubChem CID 22324526) has the molecular formula C16H21ClN2O4S and a molecular weight of 372.87 g/mol. Its IUPAC name is 1-(3-chlorophenyl)sulfonyl-2-methyl-3-pyrrolidin-1-ylpyrrolidine-2-carboxylic acid.
| Compound Name | 1-(3-chlorophenyl)sulfonyl-2-methyl-3-pyrrolidin-1-ylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 22324526 |
| Molecular Formula | C16H21ClN2O4S |
| Molecular Weight | 372.87 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 1-(3-chlorophenyl)sulfonyl-2-methyl-3-pyrrolidin-1-ylpyrrolidine-2-carboxylic acid |
| SMILES | CC1(C(=O)O)C(N2CCCC2)CCN1S(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H21ClN2O4S/c1-16(15(20)21)14(18-8-2-3-9-18)7-10-19(16)24(22,23)13-6-4-5-12(17)11-13/h4-6,11,14H,2-3,7-10H2,1H3,(H,20,21) |
| InChIKey | ZXJCCVGIWZNDBI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.87 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |