C12H12ClF2NO4S — CID 146132353
1-(3-chlorophenyl)sulfonyl-3,3-difluoropiperidine-4-carboxylic acid (PubChem CID 146132353) has the molecular formula C12H12ClF2NO4S and a molecular weight of 339.75 g/mol. Its IUPAC name is 1-(3-chlorophenyl)sulfonyl-3,3-difluoropiperidine-4-carboxylic acid.
| Compound Name | 1-(3-chlorophenyl)sulfonyl-3,3-difluoropiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 146132353 |
| Molecular Formula | C12H12ClF2NO4S |
| Molecular Weight | 339.75 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 1-(3-chlorophenyl)sulfonyl-3,3-difluoropiperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(S(=O)(=O)c2cccc(Cl)c2)CC1(F)F |
| InChI | InChI=1S/C12H12ClF2NO4S/c13-8-2-1-3-9(6-8)21(19,20)16-5-4-10(11(17)18)12(14,15)7-16/h1-3,6,10H,4-5,7H2,(H,17,18) |
| InChIKey | LHFCUWQATUTHEU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.75 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |